About 1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate
1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate (PubChem CID 75506788) has the molecular formula C11H7FN2O4S
and a molecular weight of 282.25 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate.
Molecular Properties
| Compound Name | 1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate |
| PubChem CID | 75506788 |
| Molecular Formula | C11H7FN2O4S |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate |
| SMILES | O=C(OCc1cncs1)c1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H7FN2O4S/c12-7-1-2-9(10(3-7)14(16)17)11(15)18-5-8-4-13-6-19-8/h1-4,6H,5H2 |
| InChIKey | SMBUYISKBRBOBY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate?
The IUPAC name of 1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate (CID 75506788) is 1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate.
What is the SMILES notation for 1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate?
The canonical SMILES for 1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate is O=C(OCc1cncs1)c1ccc(F)cc1[N+](=O)[O-].
What is the InChIKey of 1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate?
The InChIKey is SMBUYISKBRBOBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7FN2O4S/c12-7-1-2-9(10(3-7)14(16)17)11(15)18-5-8-4-13-6-19-8/h1-4,6H,5H2.
What are the key properties of 1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate?
1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate has a molecular weight of 282.25 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazol-5-ylmethyl 4-fluoro-2-nitrobenzoate is sourced from PubChem (CID 75506788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).