About N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine
N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine (PubChem CID 75506828) has the molecular formula C17H23NO3S
and a molecular weight of 321.44 g/mol. Its IUPAC name is N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine.
Molecular Properties
| Compound Name | N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine |
| PubChem CID | 75506828 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine |
| SMILES | CCS(=O)(=O)c1cccc(NC2C3CCOC3C23CCC3)c1 |
| InChI | InChI=1S/C17H23NO3S/c1-2-22(19,20)13-6-3-5-12(11-13)18-15-14-7-10-21-16(14)17(15)8-4-9-17/h3,5-6,11,14-16,18H,2,4,7-10H2,1H3 |
| InChIKey | DDZTVKYFLXERLM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine?
The IUPAC name of N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine (CID 75506828) is N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine.
What is the SMILES notation for N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine?
The canonical SMILES for N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine is CCS(=O)(=O)c1cccc(NC2C3CCOC3C23CCC3)c1.
What is the InChIKey of N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine?
The InChIKey is DDZTVKYFLXERLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO3S/c1-2-22(19,20)13-6-3-5-12(11-13)18-15-14-7-10-21-16(14)17(15)8-4-9-17/h3,5-6,11,14-16,18H,2,4,7-10H2,1H3.
What are the key properties of N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine?
N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine has a molecular weight of 321.44 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethylsulfonylphenyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine is sourced from PubChem (CID 75506828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).