About 5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile
5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile (PubChem CID 75506957) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is 5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile |
| PubChem CID | 75506957 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile |
| SMILES | CC1CN(Cc2ccc(C#N)o2)C(C)(C)CO1 |
| InChI | InChI=1S/C13H18N2O2/c1-10-7-15(13(2,3)9-16-10)8-12-5-4-11(6-14)17-12/h4-5,10H,7-9H2,1-3H3 |
| InChIKey | GKPVBCRHQMYHPE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile?
The IUPAC name of 5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile (CID 75506957) is 5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile.
What is the SMILES notation for 5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile?
The canonical SMILES for 5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile is CC1CN(Cc2ccc(C#N)o2)C(C)(C)CO1.
What is the InChIKey of 5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile?
The InChIKey is GKPVBCRHQMYHPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-10-7-15(13(2,3)9-16-10)8-12-5-4-11(6-14)17-12/h4-5,10H,7-9H2,1-3H3.
What are the key properties of 5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile?
5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile has a molecular weight of 234.30 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,5,5-trimethylmorpholin-4-yl)methyl]furan-2-carbonitrile is sourced from PubChem (CID 75506957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).