C16H19N5OS — CID 75507569
N,1-dimethyl-N-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]pyrazol-4-amine (PubChem CID 75507569) has the molecular formula C16H19N5OS and a molecular weight of 329.43 g/mol. Its IUPAC name is N,1-dimethyl-N-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]pyrazol-4-amine.
| Compound Name | N,1-dimethyl-N-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 75507569 |
| Molecular Formula | C16H19N5OS |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N,1-dimethyl-N-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]pyrazol-4-amine |
| SMILES | CN(Cc1nnc(-c2cc3c(s2)CCCC3)o1)c1cnn(C)c1 |
| InChI | InChI=1S/C16H19N5OS/c1-20(12-8-17-21(2)9-12)10-15-18-19-16(22-15)14-7-11-5-3-4-6-13(11)23-14/h7-9H,3-6,10H2,1-2H3 |
| InChIKey | KBZUPZFTKNOSIM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |