About 1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea
1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea (PubChem CID 75508024) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea |
| PubChem CID | 75508024 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea |
| SMILES | Cc1cc(C)nc(NC(=O)N(CCO)C2CC2)c1 |
| InChI | InChI=1S/C13H19N3O2/c1-9-7-10(2)14-12(8-9)15-13(18)16(5-6-17)11-3-4-11/h7-8,11,17H,3-6H2,1-2H3,(H,14,15,18) |
| InChIKey | JWOQMQLEIULHLV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea?
The IUPAC name of 1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea (CID 75508024) is 1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea.
What is the SMILES notation for 1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea?
The canonical SMILES for 1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea is Cc1cc(C)nc(NC(=O)N(CCO)C2CC2)c1.
What is the InChIKey of 1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea?
The InChIKey is JWOQMQLEIULHLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-9-7-10(2)14-12(8-9)15-13(18)16(5-6-17)11-3-4-11/h7-8,11,17H,3-6H2,1-2H3,(H,14,15,18).
What are the key properties of 1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea?
1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea has a molecular weight of 249.31 g/mol, XLogP of 1.69, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-(4,6-dimethyl-2-pyridinyl)-1-(2-hydroxyethyl)urea is sourced from PubChem (CID 75508024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).