C16H28N4O — CID 75508877
N-(3,4-dimethylcyclohexyl)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 75508877) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is N-(3,4-dimethylcyclohexyl)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | N-(3,4-dimethylcyclohexyl)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 75508877 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | N-(3,4-dimethylcyclohexyl)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | COCc1nc2n(n1)CC(NC1CCC(C)C(C)C1)CC2 |
| InChI | InChI=1S/C16H28N4O/c1-11-4-5-13(8-12(11)2)17-14-6-7-16-18-15(10-21-3)19-20(16)9-14/h11-14,17H,4-10H2,1-3H3 |
| InChIKey | RHCNVJRZOIPQJL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |