C17H20N2O3S — CID 75509612
N-[2-[cyclopentyl(furan-2-ylmethyl)amino]-2-oxoethyl]thiophene-3-carboxamide (PubChem CID 75509612) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is N-[2-[cyclopentyl(furan-2-ylmethyl)amino]-2-oxoethyl]thiophene-3-carboxamide.
| Compound Name | N-[2-[cyclopentyl(furan-2-ylmethyl)amino]-2-oxoethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 75509612 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[2-[cyclopentyl(furan-2-ylmethyl)amino]-2-oxoethyl]thiophene-3-carboxamide |
| SMILES | O=C(NCC(=O)N(Cc1ccco1)C1CCCC1)c1ccsc1 |
| InChI | InChI=1S/C17H20N2O3S/c20-16(10-18-17(21)13-7-9-23-12-13)19(14-4-1-2-5-14)11-15-6-3-8-22-15/h3,6-9,12,14H,1-2,4-5,10-11H2,(H,18,21) |
| InChIKey | WONZIEDZLNRQNU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |