About 1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide
1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide (PubChem CID 75509889) has the molecular formula C14H15BrN4O
and a molecular weight of 335.21 g/mol. Its IUPAC name is 1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide |
| PubChem CID | 75509889 |
| Molecular Formula | C14H15BrN4O |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide |
| SMILES | CCNC(=O)C1CN(c2ccnc3cc(Br)cnc23)C1 |
| InChI | InChI=1S/C14H15BrN4O/c1-2-16-14(20)9-7-19(8-9)12-3-4-17-11-5-10(15)6-18-13(11)12/h3-6,9H,2,7-8H2,1H3,(H,16,20) |
| InChIKey | YWYTXCYIKRNXGC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide?
The IUPAC name of 1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide (CID 75509889) is 1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide.
What is the SMILES notation for 1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide?
The canonical SMILES for 1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide is CCNC(=O)C1CN(c2ccnc3cc(Br)cnc23)C1.
What is the InChIKey of 1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide?
The InChIKey is YWYTXCYIKRNXGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN4O/c1-2-16-14(20)9-7-19(8-9)12-3-4-17-11-5-10(15)6-18-13(11)12/h3-6,9H,2,7-8H2,1H3,(H,16,20).
What are the key properties of 1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide?
1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide has a molecular weight of 335.21 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-bromo-1,5-naphthyridin-4-yl)-N-ethylazetidine-3-carboxamide is sourced from PubChem (CID 75509889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).