C19H18N2O6 — CID 75510440
methyl 1-[(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2,3-dihydroindole-5-carboxylate (PubChem CID 75510440) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is methyl 1-[(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2,3-dihydroindole-5-carboxylate.
| Compound Name | methyl 1-[(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 75510440 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | methyl 1-[(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2,3-dihydroindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCN2Cc1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C19H18N2O6/c1-25-19(22)13-2-3-15-12(8-13)4-5-20(15)11-14-9-17-18(27-7-6-26-17)10-16(14)21(23)24/h2-3,8-10H,4-7,11H2,1H3 |
| InChIKey | HWNSIXYMVGZSAE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|