C16H21N3O4 — CID 75511632
3-(2,5-dioxoimidazolidin-4-yl)-N-ethyl-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 75511632) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-(2,5-dioxoimidazolidin-4-yl)-N-ethyl-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-ethyl-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 75511632 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-ethyl-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | CCN(Cc1ccc(OC)cc1)C(=O)CCC1NC(=O)NC1=O |
| InChI | InChI=1S/C16H21N3O4/c1-3-19(10-11-4-6-12(23-2)7-5-11)14(20)9-8-13-15(21)18-16(22)17-13/h4-7,13H,3,8-10H2,1-2H3,(H2,17,18,21,22) |
| InChIKey | IMQFOHYFTKSDGX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|