About 1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride
1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride (PubChem CID 75511749) has the molecular formula C8H18ClNO3S
and a molecular weight of 243.76 g/mol. Its IUPAC name is 1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride |
| PubChem CID | 75511749 |
| Molecular Formula | C8H18ClNO3S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride |
| SMILES | CC(O)CNC1CCS(=O)(=O)CC1.Cl |
| InChI | InChI=1S/C8H17NO3S.ClH/c1-7(10)6-9-8-2-4-13(11,12)5-3-8;/h7-10H,2-6H2,1H3;1H |
| InChIKey | MQTBWABCFQMJIX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride?
The IUPAC name of 1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride (CID 75511749) is 1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride.
What is the SMILES notation for 1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride?
The canonical SMILES for 1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride is CC(O)CNC1CCS(=O)(=O)CC1.Cl.
What is the InChIKey of 1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride?
The InChIKey is MQTBWABCFQMJIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3S.ClH/c1-7(10)6-9-8-2-4-13(11,12)5-3-8;/h7-10H,2-6H2,1H3;1H.
What are the key properties of 1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride?
1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride has a molecular weight of 243.76 g/mol, XLogP of -0.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,1-dioxothian-4-yl)amino]propan-2-ol;hydrochloride is sourced from PubChem (CID 75511749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).