About 1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine
1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine (PubChem CID 75512258) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is 1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine |
| PubChem CID | 75512258 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NC1CC1C1CCCCC1 |
| InChI | InChI=1S/C12H23N3/c1-13-12(14-2)15-11-8-10(11)9-6-4-3-5-7-9/h9-11H,3-8H2,1-2H3,(H2,13,14,15) |
| InChIKey | JSLHFUGSFOKNEJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine?
The IUPAC name of 1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine (CID 75512258) is 1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine.
What is the SMILES notation for 1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine?
The canonical SMILES for 1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine is C/N=C(\NC)NC1CC1C1CCCCC1.
What is the InChIKey of 1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine?
The InChIKey is JSLHFUGSFOKNEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3/c1-13-12(14-2)15-11-8-10(11)9-6-4-3-5-7-9/h9-11H,3-8H2,1-2H3,(H2,13,14,15).
What are the key properties of 1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine?
1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine has a molecular weight of 209.34 g/mol, XLogP of 1.75, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclohexylcyclopropyl)-2,3-dimethylguanidine is sourced from PubChem (CID 75512258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).