About N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide
N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 75512975) has the molecular formula C16H32IN3O
and a molecular weight of 409.36 g/mol. Its IUPAC name is N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide |
| PubChem CID | 75512975 |
| Molecular Formula | C16H32IN3O |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCOCCC1(C/N=C(\N)N2CCCCC2)CCCC1.I |
| InChI | InChI=1S/C16H31N3O.HI/c1-2-20-13-10-16(8-4-5-9-16)14-18-15(17)19-11-6-3-7-12-19;/h2-14H2,1H3,(H2,17,18);1H |
| InChIKey | IYBMCJIPEDHWBZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide?
The IUPAC name of N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide (CID 75512975) is N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide.
What is the SMILES notation for N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide?
The canonical SMILES for N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide is CCOCCC1(C/N=C(\N)N2CCCCC2)CCCC1.I.
What is the InChIKey of N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide?
The InChIKey is IYBMCJIPEDHWBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3O.HI/c1-2-20-13-10-16(8-4-5-9-16)14-18-15(17)19-11-6-3-7-12-19;/h2-14H2,1H3,(H2,17,18);1H.
What are the key properties of N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide?
N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide has a molecular weight of 409.36 g/mol, XLogP of 3.39, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[1-(2-ethoxyethyl)cyclopentyl]methyl]piperidine-1-carboximidamide;hydroiodide is sourced from PubChem (CID 75512975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).