About thian-4-ylmethyl 5-methylpyridine-3-carboxylate
thian-4-ylmethyl 5-methylpyridine-3-carboxylate (PubChem CID 75513605) has the molecular formula C13H17NO2S
and a molecular weight of 251.35 g/mol. Its IUPAC name is thian-4-ylmethyl 5-methylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | thian-4-ylmethyl 5-methylpyridine-3-carboxylate |
| PubChem CID | 75513605 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | thian-4-ylmethyl 5-methylpyridine-3-carboxylate |
| SMILES | Cc1cncc(C(=O)OCC2CCSCC2)c1 |
| InChI | InChI=1S/C13H17NO2S/c1-10-6-12(8-14-7-10)13(15)16-9-11-2-4-17-5-3-11/h6-8,11H,2-5,9H2,1H3 |
| InChIKey | AKJKNNFHMNSQQN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thian-4-ylmethyl 5-methylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thian-4-ylmethyl 5-methylpyridine-3-carboxylate?
The IUPAC name of thian-4-ylmethyl 5-methylpyridine-3-carboxylate (CID 75513605) is thian-4-ylmethyl 5-methylpyridine-3-carboxylate.
What is the SMILES notation for thian-4-ylmethyl 5-methylpyridine-3-carboxylate?
The canonical SMILES for thian-4-ylmethyl 5-methylpyridine-3-carboxylate is Cc1cncc(C(=O)OCC2CCSCC2)c1.
What is the InChIKey of thian-4-ylmethyl 5-methylpyridine-3-carboxylate?
The InChIKey is AKJKNNFHMNSQQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2S/c1-10-6-12(8-14-7-10)13(15)16-9-11-2-4-17-5-3-11/h6-8,11H,2-5,9H2,1H3.
What are the key properties of thian-4-ylmethyl 5-methylpyridine-3-carboxylate?
thian-4-ylmethyl 5-methylpyridine-3-carboxylate has a molecular weight of 251.35 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thian-4-ylmethyl 5-methylpyridine-3-carboxylate is sourced from PubChem (CID 75513605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).