C16H15ClN4O2 — CID 75513607
3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)propyl 3-chloro-5-methylbenzoate (PubChem CID 75513607) has the molecular formula C16H15ClN4O2 and a molecular weight of 330.78 g/mol. Its IUPAC name is 3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)propyl 3-chloro-5-methylbenzoate.
| Compound Name | 3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)propyl 3-chloro-5-methylbenzoate |
|---|---|
| PubChem CID | 75513607 |
| Molecular Formula | C16H15ClN4O2 |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)propyl 3-chloro-5-methylbenzoate |
| SMILES | Cc1cc(Cl)cc(C(=O)OCCCc2nc3ncccn3n2)c1 |
| InChI | InChI=1S/C16H15ClN4O2/c1-11-8-12(10-13(17)9-11)15(22)23-7-2-4-14-19-16-18-5-3-6-21(16)20-14/h3,5-6,8-10H,2,4,7H2,1H3 |
| InChIKey | CKXGUEWZRJLKQY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|