About N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide
N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide (PubChem CID 75514098) has the molecular formula C17H18N2O4S
and a molecular weight of 346.41 g/mol. Its IUPAC name is N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide.
Molecular Properties
| Compound Name | N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide |
| PubChem CID | 75514098 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N2CC=C(c3ccccc3)CC2)co1 |
| InChI | InChI=1S/C17H18N2O4S/c1-18-24(21,22)16-11-15(12-23-16)17(20)19-9-7-14(8-10-19)13-5-3-2-4-6-13/h2-7,11-12,18H,8-10H2,1H3 |
| InChIKey | YJHQXGGYZFCOBB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide?
The IUPAC name of N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide (CID 75514098) is N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide.
What is the SMILES notation for N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide?
The canonical SMILES for N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide is CNS(=O)(=O)c1cc(C(=O)N2CC=C(c3ccccc3)CC2)co1.
What is the InChIKey of N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide?
The InChIKey is YJHQXGGYZFCOBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O4S/c1-18-24(21,22)16-11-15(12-23-16)17(20)19-9-7-14(8-10-19)13-5-3-2-4-6-13/h2-7,11-12,18H,8-10H2,1H3.
What are the key properties of N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide?
N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide has a molecular weight of 346.41 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)furan-2-sulfonamide is sourced from PubChem (CID 75514098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).