C11H24IN3O — CID 75514182
1-[2-(cyclopropylmethoxy)ethyl]-3-ethyl-1,2-dimethylguanidine;hydroiodide (PubChem CID 75514182) has the molecular formula C11H24IN3O and a molecular weight of 341.24 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethoxy)ethyl]-3-ethyl-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-ethyl-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 75514182 |
| Molecular Formula | C11H24IN3O |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-ethyl-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\C)N(C)CCOCC1CC1.I |
| InChI | InChI=1S/C11H23N3O.HI/c1-4-13-11(12-2)14(3)7-8-15-9-10-5-6-10;/h10H,4-9H2,1-3H3,(H,12,13);1H |
| InChIKey | GKZWUZUWAJEMIO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|