C14H16N4OS2 — CID 75515098
7-[(2-thiophen-2-yl-1,3-thiazol-5-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 75515098) has the molecular formula C14H16N4OS2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 7-[(2-thiophen-2-yl-1,3-thiazol-5-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-[(2-thiophen-2-yl-1,3-thiazol-5-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 75515098 |
| Molecular Formula | C14H16N4OS2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 7-[(2-thiophen-2-yl-1,3-thiazol-5-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | O=C1NCC2CN(Cc3cnc(-c4cccs4)s3)CCN12 |
| InChI | InChI=1S/C14H16N4OS2/c19-14-16-6-10-8-17(3-4-18(10)14)9-11-7-15-13(21-11)12-2-1-5-20-12/h1-2,5,7,10H,3-4,6,8-9H2,(H,16,19) |
| InChIKey | NIYLEHNAGKLJHF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |