C14H18BrN3O — CID 75515190
1-(4-bromophenyl)-2-(3,5-diethyl-1,2,4-triazol-1-yl)ethanol (PubChem CID 75515190) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(3,5-diethyl-1,2,4-triazol-1-yl)ethanol.
| Compound Name | 1-(4-bromophenyl)-2-(3,5-diethyl-1,2,4-triazol-1-yl)ethanol |
|---|---|
| PubChem CID | 75515190 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-(4-bromophenyl)-2-(3,5-diethyl-1,2,4-triazol-1-yl)ethanol |
| SMILES | CCc1nc(CC)n(CC(O)c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C14H18BrN3O/c1-3-13-16-14(4-2)18(17-13)9-12(19)10-5-7-11(15)8-6-10/h5-8,12,19H,3-4,9H2,1-2H3 |
| InChIKey | RBPUJPGNKVURSU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |