C15H26N4O — CID 75516192
N-(2,2-diethyl-3-methoxycyclobutyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 75516192) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is N-(2,2-diethyl-3-methoxycyclobutyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | N-(2,2-diethyl-3-methoxycyclobutyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 75516192 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | N-(2,2-diethyl-3-methoxycyclobutyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | CCC1(CC)C(NC2CCCn3ncnc32)CC1OC |
| InChI | InChI=1S/C15H26N4O/c1-4-15(5-2)12(9-13(15)20-3)18-11-7-6-8-19-14(11)16-10-17-19/h10-13,18H,4-9H2,1-3H3 |
| InChIKey | WLKJJUYDIFVTAJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |