C18H30N4O — CID 75516211
N-(3-ethoxyspiro[3.5]nonan-1-yl)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 75516211) has the molecular formula C18H30N4O and a molecular weight of 318.47 g/mol. Its IUPAC name is N-(3-ethoxyspiro[3.5]nonan-1-yl)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | N-(3-ethoxyspiro[3.5]nonan-1-yl)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 75516211 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | N-(3-ethoxyspiro[3.5]nonan-1-yl)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | CCOC1CC(NC2CCCn3nc(C)nc32)C12CCCCC2 |
| InChI | InChI=1S/C18H30N4O/c1-3-23-16-12-15(18(16)9-5-4-6-10-18)20-14-8-7-11-22-17(14)19-13(2)21-22/h14-16,20H,3-12H2,1-2H3 |
| InChIKey | RCCZIPMICSYKBH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |