About N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine
N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine (PubChem CID 75516219) has the molecular formula C15H19FN2O
and a molecular weight of 262.33 g/mol. Its IUPAC name is N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine.
Molecular Properties
| Compound Name | N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine |
| PubChem CID | 75516219 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine |
| SMILES | Fc1cccnc1CNC1C2CCOC2C12CCC2 |
| InChI | InChI=1S/C15H19FN2O/c16-11-3-1-7-17-12(11)9-18-13-10-4-8-19-14(10)15(13)5-2-6-15/h1,3,7,10,13-14,18H,2,4-6,8-9H2 |
| InChIKey | PUBHLBKEFMHMNM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine?
The IUPAC name of N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine (CID 75516219) is N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine.
What is the SMILES notation for N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine?
The canonical SMILES for N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine is Fc1cccnc1CNC1C2CCOC2C12CCC2.
What is the InChIKey of N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine?
The InChIKey is PUBHLBKEFMHMNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN2O/c16-11-3-1-7-17-12(11)9-18-13-10-4-8-19-14(10)15(13)5-2-6-15/h1,3,7,10,13-14,18H,2,4-6,8-9H2.
What are the key properties of N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine?
N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine has a molecular weight of 262.33 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-fluoro-2-pyridinyl)methyl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine is sourced from PubChem (CID 75516219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).