C18H23NO — CID 755165
(E)-1-(2,2,4,6,7-pentamethylquinolin-1-yl)but-2-en-1-one (PubChem CID 755165) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is (E)-1-(2,2,4,6,7-pentamethylquinolin-1-yl)but-2-en-1-one.
| Compound Name | (E)-1-(2,2,4,6,7-pentamethylquinolin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 755165 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | (E)-1-(2,2,4,6,7-pentamethylquinolin-1-yl)but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1c2cc(C)c(C)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C18H23NO/c1-7-8-17(20)19-16-10-13(3)12(2)9-15(16)14(4)11-18(19,5)6/h7-11H,1-6H3/b8-7+ |
| InChIKey | NXJIKOYNOGVTEY-BQYQJAHWSA-N |
| XLogP | 4.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|