C20H20N2O3 — CID 75516623
4-[3-[2-(1H-indol-2-yl)ethylamino]-3-oxopropyl]benzoic acid (PubChem CID 75516623) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[3-[2-(1H-indol-2-yl)ethylamino]-3-oxopropyl]benzoic acid.
| Compound Name | 4-[3-[2-(1H-indol-2-yl)ethylamino]-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 75516623 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 4-[3-[2-(1H-indol-2-yl)ethylamino]-3-oxopropyl]benzoic acid |
| SMILES | O=C(CCc1ccc(C(=O)O)cc1)NCCc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H20N2O3/c23-19(10-7-14-5-8-15(9-6-14)20(24)25)21-12-11-17-13-16-3-1-2-4-18(16)22-17/h1-6,8-9,13,22H,7,10-12H2,(H,21,23)(H,24,25) |
| InChIKey | HDWOHGDDKAVELP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |