About (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate
(6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate (PubChem CID 75516846) has the molecular formula C15H11FN2O4
and a molecular weight of 302.26 g/mol. Its IUPAC name is (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate.
Molecular Properties
| Compound Name | (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate |
| PubChem CID | 75516846 |
| Molecular Formula | C15H11FN2O4 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate |
| SMILES | Cc1cc(C(=O)OCc2nc3ccc(F)cc3o2)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H11FN2O4/c1-8-4-9(5-13(19)17-8)15(20)21-7-14-18-11-3-2-10(16)6-12(11)22-14/h2-6H,7H2,1H3,(H,17,19) |
| InChIKey | UPYZKCVXKQQDIO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate?
The IUPAC name of (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate (CID 75516846) is (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate.
What is the SMILES notation for (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate?
The canonical SMILES for (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate is Cc1cc(C(=O)OCc2nc3ccc(F)cc3o2)cc(=O)[nH]1.
What is the InChIKey of (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate?
The InChIKey is UPYZKCVXKQQDIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11FN2O4/c1-8-4-9(5-13(19)17-8)15(20)21-7-14-18-11-3-2-10(16)6-12(11)22-14/h2-6H,7H2,1H3,(H,17,19).
What are the key properties of (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate?
(6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate has a molecular weight of 302.26 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate is sourced from PubChem (CID 75516846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).