C21H25N5 — CID 75516974
N-[2-(3-methylpyrazol-1-yl)phenyl]-1-(pyridin-4-ylmethyl)piperidin-4-amine (PubChem CID 75516974) has the molecular formula C21H25N5 and a molecular weight of 347.47 g/mol. Its IUPAC name is N-[2-(3-methylpyrazol-1-yl)phenyl]-1-(pyridin-4-ylmethyl)piperidin-4-amine.
| Compound Name | N-[2-(3-methylpyrazol-1-yl)phenyl]-1-(pyridin-4-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 75516974 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | N-[2-(3-methylpyrazol-1-yl)phenyl]-1-(pyridin-4-ylmethyl)piperidin-4-amine |
| SMILES | Cc1ccn(-c2ccccc2NC2CCN(Cc3ccncc3)CC2)n1 |
| InChI | InChI=1S/C21H25N5/c1-17-8-15-26(24-17)21-5-3-2-4-20(21)23-19-9-13-25(14-10-19)16-18-6-11-22-12-7-18/h2-8,11-12,15,19,23H,9-10,13-14,16H2,1H3 |
| InChIKey | WXXWKFHURIRTRM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |