C18H22N2O3 — CID 755172
1,3-dimethyl-2-(2,4,5-trimethoxyphenyl)-2H-benzimidazole (PubChem CID 755172) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1,3-dimethyl-2-(2,4,5-trimethoxyphenyl)-2H-benzimidazole.
| Compound Name | 1,3-dimethyl-2-(2,4,5-trimethoxyphenyl)-2H-benzimidazole |
|---|---|
| PubChem CID | 755172 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1,3-dimethyl-2-(2,4,5-trimethoxyphenyl)-2H-benzimidazole |
| SMILES | COc1cc(OC)c(C2N(C)c3ccccc3N2C)cc1OC |
| InChI | InChI=1S/C18H22N2O3/c1-19-13-8-6-7-9-14(13)20(2)18(19)12-10-16(22-4)17(23-5)11-15(12)21-3/h6-11,18H,1-5H3 |
| InChIKey | FCKBMOLMHRGZRR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |