C13H17N3O2S — CID 75517293
6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4,6-diazaspiro[2.4]heptane-5,7-dione (PubChem CID 75517293) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4,6-diazaspiro[2.4]heptane-5,7-dione.
| Compound Name | 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4,6-diazaspiro[2.4]heptane-5,7-dione |
|---|---|
| PubChem CID | 75517293 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 6-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-4,6-diazaspiro[2.4]heptane-5,7-dione |
| SMILES | CC(C)(C)c1csc(CN2C(=O)NC3(CC3)C2=O)n1 |
| InChI | InChI=1S/C13H17N3O2S/c1-12(2,3)8-7-19-9(14-8)6-16-10(17)13(4-5-13)15-11(16)18/h7H,4-6H2,1-3H3,(H,15,18) |
| InChIKey | CFOGTQXOCWUQMT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|