C9H6F3N3O3S — CID 75517545
3,4,5-trifluoro-N-(5-methyl-1,2,4-oxadiazol-3-yl)benzenesulfonamide (PubChem CID 75517545) has the molecular formula C9H6F3N3O3S and a molecular weight of 293.23 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-(5-methyl-1,2,4-oxadiazol-3-yl)benzenesulfonamide.
| Compound Name | 3,4,5-trifluoro-N-(5-methyl-1,2,4-oxadiazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 75517545 |
| Molecular Formula | C9H6F3N3O3S |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 3,4,5-trifluoro-N-(5-methyl-1,2,4-oxadiazol-3-yl)benzenesulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2cc(F)c(F)c(F)c2)no1 |
| InChI | InChI=1S/C9H6F3N3O3S/c1-4-13-9(14-18-4)15-19(16,17)5-2-6(10)8(12)7(11)3-5/h2-3H,1H3,(H,14,15) |
| InChIKey | NQUSZLSSJHPEOI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|