C18H31N5O2 — CID 75517877
1-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-(2,2,5,5-tetramethyloxolan-3-yl)urea (PubChem CID 75517877) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-(2,2,5,5-tetramethyloxolan-3-yl)urea.
| Compound Name | 1-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-(2,2,5,5-tetramethyloxolan-3-yl)urea |
|---|---|
| PubChem CID | 75517877 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 1-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-(2,2,5,5-tetramethyloxolan-3-yl)urea |
| SMILES | CC(C)c1nc2n(n1)CCCC2NC(=O)NC1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C18H31N5O2/c1-11(2)14-21-15-12(8-7-9-23(15)22-14)19-16(24)20-13-10-17(3,4)25-18(13,5)6/h11-13H,7-10H2,1-6H3,(H2,19,20,24) |
| InChIKey | YXJFVJKAYQNFIS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |