C18H26N4O2 — CID 75518103
3-[1-[4-(cyclopropylcarbamoylamino)phenyl]ethyl]-1-methyl-1-(2-methylprop-2-enyl)urea (PubChem CID 75518103) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-[1-[4-(cyclopropylcarbamoylamino)phenyl]ethyl]-1-methyl-1-(2-methylprop-2-enyl)urea.
| Compound Name | 3-[1-[4-(cyclopropylcarbamoylamino)phenyl]ethyl]-1-methyl-1-(2-methylprop-2-enyl)urea |
|---|---|
| PubChem CID | 75518103 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 3-[1-[4-(cyclopropylcarbamoylamino)phenyl]ethyl]-1-methyl-1-(2-methylprop-2-enyl)urea |
| SMILES | C=C(C)CN(C)C(=O)NC(C)c1ccc(NC(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C18H26N4O2/c1-12(2)11-22(4)18(24)19-13(3)14-5-7-15(8-6-14)20-17(23)21-16-9-10-16/h5-8,13,16H,1,9-11H2,2-4H3,(H,19,24)(H2,20,21,23) |
| InChIKey | QIKZAMYHUBSAPF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|