About 1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate
1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate (PubChem CID 75518650) has the molecular formula C16H17FN2O3
and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate.
Molecular Properties
| Compound Name | 1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate |
| PubChem CID | 75518650 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate |
| SMILES | CC(=O)NCC(C)OC(=O)c1cc(C)nc2cc(F)ccc12 |
| InChI | InChI=1S/C16H17FN2O3/c1-9-6-14(13-5-4-12(17)7-15(13)19-9)16(21)22-10(2)8-18-11(3)20/h4-7,10H,8H2,1-3H3,(H,18,20) |
| InChIKey | XSZOWGRFYWWQRX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate?
The IUPAC name of 1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate (CID 75518650) is 1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate.
What is the SMILES notation for 1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate?
The canonical SMILES for 1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate is CC(=O)NCC(C)OC(=O)c1cc(C)nc2cc(F)ccc12.
What is the InChIKey of 1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate?
The InChIKey is XSZOWGRFYWWQRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2O3/c1-9-6-14(13-5-4-12(17)7-15(13)19-9)16(21)22-10(2)8-18-11(3)20/h4-7,10H,8H2,1-3H3,(H,18,20).
What are the key properties of 1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate?
1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate has a molecular weight of 304.32 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetamidopropan-2-yl 7-fluoro-2-methylquinoline-4-carboxylate is sourced from PubChem (CID 75518650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).