About 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide
2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide (PubChem CID 75518807) has the molecular formula C13H22N2O3S
and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide |
| PubChem CID | 75518807 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide |
| SMILES | Cc1nc(CC(=O)N(C)CC(C)(CO)CO)c(C)s1 |
| InChI | InChI=1S/C13H22N2O3S/c1-9-11(14-10(2)19-9)5-12(18)15(4)6-13(3,7-16)8-17/h16-17H,5-8H2,1-4H3 |
| InChIKey | XACNPVCSBBEFQS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide?
The IUPAC name of 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide (CID 75518807) is 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide.
What is the SMILES notation for 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide?
The canonical SMILES for 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide is Cc1nc(CC(=O)N(C)CC(C)(CO)CO)c(C)s1.
What is the InChIKey of 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide?
The InChIKey is XACNPVCSBBEFQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3S/c1-9-11(14-10(2)19-9)5-12(18)15(4)6-13(3,7-16)8-17/h16-17H,5-8H2,1-4H3.
What are the key properties of 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide?
2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide has a molecular weight of 286.40 g/mol, XLogP of 0.75, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methylacetamide is sourced from PubChem (CID 75518807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).