C16H21NO3 — CID 75518815
2-(3-hydroxyphenyl)-1-(9-oxa-6-azaspiro[4.5]decan-6-yl)ethanone (PubChem CID 75518815) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-1-(9-oxa-6-azaspiro[4.5]decan-6-yl)ethanone.
| Compound Name | 2-(3-hydroxyphenyl)-1-(9-oxa-6-azaspiro[4.5]decan-6-yl)ethanone |
|---|---|
| PubChem CID | 75518815 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-(3-hydroxyphenyl)-1-(9-oxa-6-azaspiro[4.5]decan-6-yl)ethanone |
| SMILES | O=C(Cc1cccc(O)c1)N1CCOCC12CCCC2 |
| InChI | InChI=1S/C16H21NO3/c18-14-5-3-4-13(10-14)11-15(19)17-8-9-20-12-16(17)6-1-2-7-16/h3-5,10,18H,1-2,6-9,11-12H2 |
| InChIKey | UAKKBNCDDJLZOH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |