About N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide
N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 75519639) has the molecular formula C11H10F3N3O3S
and a molecular weight of 321.28 g/mol. Its IUPAC name is N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide |
| PubChem CID | 75519639 |
| Molecular Formula | C11H10F3N3O3S |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | Cc1cnc(CNS(=O)(=O)c2ccc(C(F)(F)F)nc2)o1 |
| InChI | InChI=1S/C11H10F3N3O3S/c1-7-4-16-10(20-7)6-17-21(18,19)8-2-3-9(15-5-8)11(12,13)14/h2-5,17H,6H2,1H3 |
| InChIKey | ZGIIBPBPTGVWJV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide?
The IUPAC name of N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide (CID 75519639) is N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide.
What is the SMILES notation for N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide?
The canonical SMILES for N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide is Cc1cnc(CNS(=O)(=O)c2ccc(C(F)(F)F)nc2)o1.
What is the InChIKey of N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide?
The InChIKey is ZGIIBPBPTGVWJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3N3O3S/c1-7-4-16-10(20-7)6-17-21(18,19)8-2-3-9(15-5-8)11(12,13)14/h2-5,17H,6H2,1H3.
What are the key properties of N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide?
N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide has a molecular weight of 321.28 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-methyl-1,3-oxazol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-sulfonamide is sourced from PubChem (CID 75519639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).