About N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide
N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide (PubChem CID 75519842) has the molecular formula C15H17F2N3O2
and a molecular weight of 309.32 g/mol. Its IUPAC name is N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide |
| PubChem CID | 75519842 |
| Molecular Formula | C15H17F2N3O2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide |
| SMILES | CC(C)(C)Oc1c(F)cc(NC(=O)Cc2ccn[nH]2)cc1F |
| InChI | InChI=1S/C15H17F2N3O2/c1-15(2,3)22-14-11(16)6-10(7-12(14)17)19-13(21)8-9-4-5-18-20-9/h4-7H,8H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | JRFYCEGJIJQOSG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide?
The IUPAC name of N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide (CID 75519842) is N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide.
What is the SMILES notation for N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide?
The canonical SMILES for N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide is CC(C)(C)Oc1c(F)cc(NC(=O)Cc2ccn[nH]2)cc1F.
What is the InChIKey of N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide?
The InChIKey is JRFYCEGJIJQOSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2N3O2/c1-15(2,3)22-14-11(16)6-10(7-12(14)17)19-13(21)8-9-4-5-18-20-9/h4-7H,8H2,1-3H3,(H,18,20)(H,19,21).
What are the key properties of N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide?
N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide has a molecular weight of 309.32 g/mol, XLogP of 3.05, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-difluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1H-pyrazol-5-yl)acetamide is sourced from PubChem (CID 75519842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).