About 2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine
2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine (PubChem CID 75520180) has the molecular formula C10H11F2NO3S
and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine.
Molecular Properties
| Compound Name | 2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine |
| PubChem CID | 75520180 |
| Molecular Formula | C10H11F2NO3S |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine |
| SMILES | Cc1cc(S(=O)(=O)N2CCCO2)c(F)cc1F |
| InChI | InChI=1S/C10H11F2NO3S/c1-7-5-10(9(12)6-8(7)11)17(14,15)13-3-2-4-16-13/h5-6H,2-4H2,1H3 |
| InChIKey | PJJADXURBZSLFO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine?
The IUPAC name of 2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine (CID 75520180) is 2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine.
What is the SMILES notation for 2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine?
The canonical SMILES for 2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine is Cc1cc(S(=O)(=O)N2CCCO2)c(F)cc1F.
What is the InChIKey of 2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine?
The InChIKey is PJJADXURBZSLFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO3S/c1-7-5-10(9(12)6-8(7)11)17(14,15)13-3-2-4-16-13/h5-6H,2-4H2,1H3.
What are the key properties of 2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine?
2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine has a molecular weight of 263.26 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluoro-5-methylphenyl)sulfonyl-1,2-oxazolidine is sourced from PubChem (CID 75520180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).