C19H21N3O6S — CID 75520323
N-[[5-methoxy-2-(methoxymethoxy)phenyl]methyl]-5-(4-methylsulfonylphenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 75520323) has the molecular formula C19H21N3O6S and a molecular weight of 419.46 g/mol. Its IUPAC name is N-[[5-methoxy-2-(methoxymethoxy)phenyl]methyl]-5-(4-methylsulfonylphenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-[[5-methoxy-2-(methoxymethoxy)phenyl]methyl]-5-(4-methylsulfonylphenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 75520323 |
| Molecular Formula | C19H21N3O6S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-[[5-methoxy-2-(methoxymethoxy)phenyl]methyl]-5-(4-methylsulfonylphenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | COCOc1ccc(OC)cc1CNc1nnc(-c2ccc(S(C)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C19H21N3O6S/c1-25-12-27-17-9-6-15(26-2)10-14(17)11-20-19-22-21-18(28-19)13-4-7-16(8-5-13)29(3,23)24/h4-10H,11-12H2,1-3H3,(H,20,22) |
| InChIKey | BTGPMHWYIPXGFV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|