About 4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide
4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide (PubChem CID 75520385) has the molecular formula C13H15F2N3O3S
and a molecular weight of 331.34 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide |
| PubChem CID | 75520385 |
| Molecular Formula | C13H15F2N3O3S |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(OCC(F)F)cc2)n(C)n1 |
| InChI | InChI=1S/C13H15F2N3O3S/c1-9-7-13(18(2)16-9)17-22(19,20)11-5-3-10(4-6-11)21-8-12(14)15/h3-7,12,17H,8H2,1-2H3 |
| InChIKey | HNBYABVNVSOEPL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide?
The IUPAC name of 4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide (CID 75520385) is 4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide.
What is the SMILES notation for 4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide?
The canonical SMILES for 4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide is Cc1cc(NS(=O)(=O)c2ccc(OCC(F)F)cc2)n(C)n1.
What is the InChIKey of 4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide?
The InChIKey is HNBYABVNVSOEPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2N3O3S/c1-9-7-13(18(2)16-9)17-22(19,20)11-5-3-10(4-6-11)21-8-12(14)15/h3-7,12,17H,8H2,1-2H3.
What are the key properties of 4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide?
4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide has a molecular weight of 331.34 g/mol, XLogP of 2.17, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoroethoxy)-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide is sourced from PubChem (CID 75520385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).