About N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide
N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide (PubChem CID 75520566) has the molecular formula C16H29N3O3S
and a molecular weight of 343.49 g/mol. Its IUPAC name is N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide |
| PubChem CID | 75520566 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide |
| SMILES | Cc1nn(CC(C)C)c(C)c1S(=O)(=O)NC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C16H29N3O3S/c1-10(2)9-19-14(6)16(13(5)17-19)23(20,21)18-15-7-11(3)22-12(4)8-15/h10-12,15,18H,7-9H2,1-6H3 |
| InChIKey | XAMGBDGNMJRWPR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide?
The IUPAC name of N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide (CID 75520566) is N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide.
What is the SMILES notation for N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide?
The canonical SMILES for N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide is Cc1nn(CC(C)C)c(C)c1S(=O)(=O)NC1CC(C)OC(C)C1.
What is the InChIKey of N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide?
The InChIKey is XAMGBDGNMJRWPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N3O3S/c1-10(2)9-19-14(6)16(13(5)17-19)23(20,21)18-15-7-11(3)22-12(4)8-15/h10-12,15,18H,7-9H2,1-6H3.
What are the key properties of N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide?
N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide has a molecular weight of 343.49 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethyloxan-4-yl)-3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide is sourced from PubChem (CID 75520566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).