C17H21FN4O — CID 75520895
N-[3-(3-fluoroanilino)propyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 75520895) has the molecular formula C17H21FN4O and a molecular weight of 316.38 g/mol. Its IUPAC name is N-[3-(3-fluoroanilino)propyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-[3-(3-fluoroanilino)propyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 75520895 |
| Molecular Formula | C17H21FN4O |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N-[3-(3-fluoroanilino)propyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | O=C(NCCCNc1cccc(F)c1)c1cnn2c1CCCC2 |
| InChI | InChI=1S/C17H21FN4O/c18-13-5-3-6-14(11-13)19-8-4-9-20-17(23)15-12-21-22-10-2-1-7-16(15)22/h3,5-6,11-12,19H,1-2,4,7-10H2,(H,20,23) |
| InChIKey | ZRKZZOVJMHOPPT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|