C14H14FN3S — CID 75521474
2-[1-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethylamino]acetonitrile (PubChem CID 75521474) has the molecular formula C14H14FN3S and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-[1-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethylamino]acetonitrile.
| Compound Name | 2-[1-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethylamino]acetonitrile |
|---|---|
| PubChem CID | 75521474 |
| Molecular Formula | C14H14FN3S |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-[1-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethylamino]acetonitrile |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1C(C)NCC#N |
| InChI | InChI=1S/C14H14FN3S/c1-9(17-8-7-16)13-10(2)18-14(19-13)11-3-5-12(15)6-4-11/h3-6,9,17H,8H2,1-2H3 |
| InChIKey | GKOISWQVYDVVDP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|