C16H20N2O4S — CID 75521933
3-[4-(2,5-dimethylfuran-3-yl)sulfonylpiperazin-1-yl]phenol (PubChem CID 75521933) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 3-[4-(2,5-dimethylfuran-3-yl)sulfonylpiperazin-1-yl]phenol.
| Compound Name | 3-[4-(2,5-dimethylfuran-3-yl)sulfonylpiperazin-1-yl]phenol |
|---|---|
| PubChem CID | 75521933 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-[4-(2,5-dimethylfuran-3-yl)sulfonylpiperazin-1-yl]phenol |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(c3cccc(O)c3)CC2)c(C)o1 |
| InChI | InChI=1S/C16H20N2O4S/c1-12-10-16(13(2)22-12)23(20,21)18-8-6-17(7-9-18)14-4-3-5-15(19)11-14/h3-5,10-11,19H,6-9H2,1-2H3 |
| InChIKey | IDIDCTMJTNWTIX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |