C14H26N4O2S — CID 75522291
N-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)pentane-1-sulfonamide (PubChem CID 75522291) has the molecular formula C14H26N4O2S and a molecular weight of 314.46 g/mol. Its IUPAC name is N-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)pentane-1-sulfonamide.
| Compound Name | N-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 75522291 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)pentane-1-sulfonamide |
| SMILES | CCCCCS(=O)(=O)NC1CCCn2nc(C(C)C)nc21 |
| InChI | InChI=1S/C14H26N4O2S/c1-4-5-6-10-21(19,20)17-12-8-7-9-18-14(12)15-13(16-18)11(2)3/h11-12,17H,4-10H2,1-3H3 |
| InChIKey | MFDROMQGBACGGX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|