C18H16N4 — CID 75522343
2-[4-[(3-phenyl-1H-pyrazol-5-yl)methylamino]phenyl]acetonitrile (PubChem CID 75522343) has the molecular formula C18H16N4 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[4-[(3-phenyl-1H-pyrazol-5-yl)methylamino]phenyl]acetonitrile.
| Compound Name | 2-[4-[(3-phenyl-1H-pyrazol-5-yl)methylamino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 75522343 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-[4-[(3-phenyl-1H-pyrazol-5-yl)methylamino]phenyl]acetonitrile |
| SMILES | N#CCc1ccc(NCc2cc(-c3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C18H16N4/c19-11-10-14-6-8-16(9-7-14)20-13-17-12-18(22-21-17)15-4-2-1-3-5-15/h1-9,12,20H,10,13H2,(H,21,22) |
| InChIKey | GDZNSHXGJAZODA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |