About N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide
N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide (PubChem CID 75522358) has the molecular formula C9H14N2O3S
and a molecular weight of 230.29 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 75522358 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide |
| SMILES | CCc1cnc(C(=O)NCC(O)CO)s1 |
| InChI | InChI=1S/C9H14N2O3S/c1-2-7-4-11-9(15-7)8(14)10-3-6(13)5-12/h4,6,12-13H,2-3,5H2,1H3,(H,10,14) |
| InChIKey | XUBRRQPINNFQOJ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide?
The IUPAC name of N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide (CID 75522358) is N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide is CCc1cnc(C(=O)NCC(O)CO)s1.
What is the InChIKey of N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide?
The InChIKey is XUBRRQPINNFQOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3S/c1-2-7-4-11-9(15-7)8(14)10-3-6(13)5-12/h4,6,12-13H,2-3,5H2,1H3,(H,10,14).
What are the key properties of N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide?
N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide has a molecular weight of 230.29 g/mol, XLogP of -0.21, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydroxypropyl)-5-ethyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 75522358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).