C15H27N5O2 — CID 75522407
1-(4-methoxy-2,2-dimethylbutyl)-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea (PubChem CID 75522407) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-(4-methoxy-2,2-dimethylbutyl)-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea.
| Compound Name | 1-(4-methoxy-2,2-dimethylbutyl)-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
|---|---|
| PubChem CID | 75522407 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 1-(4-methoxy-2,2-dimethylbutyl)-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
| SMILES | COCCC(C)(C)CNC(=O)NC1CCc2nc(C)nn2C1 |
| InChI | InChI=1S/C15H27N5O2/c1-11-17-13-6-5-12(9-20(13)19-11)18-14(21)16-10-15(2,3)7-8-22-4/h12H,5-10H2,1-4H3,(H2,16,18,21) |
| InChIKey | DSMOYQYIVLKTEN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |