About N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide
N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide (PubChem CID 75522734) has the molecular formula C12H11ClN2O3S2
and a molecular weight of 330.82 g/mol. Its IUPAC name is N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide |
| PubChem CID | 75522734 |
| Molecular Formula | C12H11ClN2O3S2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide |
| SMILES | Cc1cccc(S(=O)(=O)NC(=O)c2csnc2C)c1Cl |
| InChI | InChI=1S/C12H11ClN2O3S2/c1-7-4-3-5-10(11(7)13)20(17,18)15-12(16)9-6-19-14-8(9)2/h3-6H,1-2H3,(H,15,16) |
| InChIKey | COWBIUWRZVZGBN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide?
The IUPAC name of N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide (CID 75522734) is N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide.
What is the SMILES notation for N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide?
The canonical SMILES for N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide is Cc1cccc(S(=O)(=O)NC(=O)c2csnc2C)c1Cl.
What is the InChIKey of N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide?
The InChIKey is COWBIUWRZVZGBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2O3S2/c1-7-4-3-5-10(11(7)13)20(17,18)15-12(16)9-6-19-14-8(9)2/h3-6H,1-2H3,(H,15,16).
What are the key properties of N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide?
N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide has a molecular weight of 330.82 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-3-methylphenyl)sulfonyl-3-methyl-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 75522734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).