C13H9Cl2N3O2S — CID 75523599
2-chloro-N-(3-chloro-2-methyl-4-pyridinyl)-4-cyanobenzenesulfonamide (PubChem CID 75523599) has the molecular formula C13H9Cl2N3O2S and a molecular weight of 342.21 g/mol. Its IUPAC name is 2-chloro-N-(3-chloro-2-methyl-4-pyridinyl)-4-cyanobenzenesulfonamide.
| Compound Name | 2-chloro-N-(3-chloro-2-methyl-4-pyridinyl)-4-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 75523599 |
| Molecular Formula | C13H9Cl2N3O2S |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 2-chloro-N-(3-chloro-2-methyl-4-pyridinyl)-4-cyanobenzenesulfonamide |
| SMILES | Cc1nccc(NS(=O)(=O)c2ccc(C#N)cc2Cl)c1Cl |
| InChI | InChI=1S/C13H9Cl2N3O2S/c1-8-13(15)11(4-5-17-8)18-21(19,20)12-3-2-9(7-16)6-10(12)14/h2-6H,1H3,(H,17,18) |
| InChIKey | NRHCSVMZCWNQSY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |