About N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine
N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine (PubChem CID 75523756) has the molecular formula C16H17F2N3O
and a molecular weight of 305.33 g/mol. Its IUPAC name is N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine.
Molecular Properties
| Compound Name | N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine |
| PubChem CID | 75523756 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine |
| SMILES | Fc1cc2ncc(N(CC3CCOC3)C3CC3)nc2cc1F |
| InChI | InChI=1S/C16H17F2N3O/c17-12-5-14-15(6-13(12)18)20-16(7-19-14)21(11-1-2-11)8-10-3-4-22-9-10/h5-7,10-11H,1-4,8-9H2 |
| InChIKey | SRZUEQQYCPZNCH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine?
The IUPAC name of N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine (CID 75523756) is N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine.
What is the SMILES notation for N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine?
The canonical SMILES for N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine is Fc1cc2ncc(N(CC3CCOC3)C3CC3)nc2cc1F.
What is the InChIKey of N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine?
The InChIKey is SRZUEQQYCPZNCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N3O/c17-12-5-14-15(6-13(12)18)20-16(7-19-14)21(11-1-2-11)8-10-3-4-22-9-10/h5-7,10-11H,1-4,8-9H2.
What are the key properties of N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine?
N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine has a molecular weight of 305.33 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-6,7-difluoro-N-(oxolan-3-ylmethyl)quinoxalin-2-amine is sourced from PubChem (CID 75523756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).